C14H11N3O2 — CID 43120309
3-[5-(6-methyl-2-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 43120309) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-[5-(6-methyl-2-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(6-methyl-2-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 43120309 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[5-(6-methyl-2-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Cc1cccc(-c2nc(-c3cccc(O)c3)no2)n1 |
| InChI | InChI=1S/C14H11N3O2/c1-9-4-2-7-12(15-9)14-16-13(17-19-14)10-5-3-6-11(18)8-10/h2-8,18H,1H3 |
| InChIKey | WVGSXZSEQQEXKH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |