C13H10N2O3 — CID 104791040
3-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 104791040) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 3-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 104791040 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Cc1occc1-c1noc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C13H10N2O3/c1-8-11(5-6-17-8)12-14-13(18-15-12)9-3-2-4-10(16)7-9/h2-7,16H,1H3 |
| InChIKey | CNRYARGDPZIFBI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |