C14H9N3O4 — CID 28942061
3-[5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 28942061) has the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. Its IUPAC name is 3-[5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 28942061 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc(-c2cccc(O)c2)no1 |
| InChI | InChI=1S/C14H9N3O4/c18-10-5-3-4-9(8-10)13-15-14(21-16-13)11-6-1-2-7-12(11)17(19)20/h1-8,18H |
| InChIKey | AQGUCWHEMHLBAG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|