C14H8N4O5 — CID 8895310
5-(2,4-dinitrophenyl)-3-phenyl-1,2,4-oxadiazole (PubChem CID 8895310) has the molecular formula C14H8N4O5 and a molecular weight of 312.24 g/mol. Its IUPAC name is 5-(2,4-dinitrophenyl)-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-(2,4-dinitrophenyl)-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 8895310 |
| Molecular Formula | C14H8N4O5 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-(2,4-dinitrophenyl)-3-phenyl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccccc3)no2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8N4O5/c19-17(20)10-6-7-11(12(8-10)18(21)22)14-15-13(16-23-14)9-4-2-1-3-5-9/h1-8H |
| InChIKey | ZEKGIZAWOPVVMN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|