C14H7ClN4O5 — CID 8895316
3-(4-chlorophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole (PubChem CID 8895316) has the molecular formula C14H7ClN4O5 and a molecular weight of 346.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-chlorophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 8895316 |
| Molecular Formula | C14H7ClN4O5 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccc(Cl)cc3)no2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7ClN4O5/c15-9-3-1-8(2-4-9)13-16-14(24-17-13)11-6-5-10(18(20)21)7-12(11)19(22)23/h1-7H |
| InChIKey | ZQDDUNAQWHUJQA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|