C14H6Cl3N3O5S — CID 19330764
2,4-dichloro-5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]benzenesulfonyl chloride (PubChem CID 19330764) has the molecular formula C14H6Cl3N3O5S and a molecular weight of 434.64 g/mol. Its IUPAC name is 2,4-dichloro-5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]benzenesulfonyl chloride.
| Compound Name | 2,4-dichloro-5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 19330764 |
| Molecular Formula | C14H6Cl3N3O5S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 2,4-dichloro-5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]benzenesulfonyl chloride |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(-c3cc(S(=O)(=O)Cl)c(Cl)cc3Cl)n2)cc1 |
| InChI | InChI=1S/C14H6Cl3N3O5S/c15-10-6-11(16)12(26(17,23)24)5-9(10)14-18-13(19-25-14)7-1-3-8(4-2-7)20(21)22/h1-6H |
| InChIKey | BPZJMZFAQXMREW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 116.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|