C13H7N5O3 — CID 136683189
5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrrole-2-carbonitrile (PubChem CID 136683189) has the molecular formula C13H7N5O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrrole-2-carbonitrile.
| Compound Name | 5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 136683189 |
| Molecular Formula | C13H7N5O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2nc(-c3ccc([N+](=O)[O-])cc3)no2)[nH]1 |
| InChI | InChI=1S/C13H7N5O3/c14-7-9-3-6-11(15-9)13-16-12(17-21-13)8-1-4-10(5-2-8)18(19)20/h1-6,15H |
| InChIKey | FLNNEUCGEGONCK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|