C12H7N5O5 — CID 136912325
5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrimidine-2,4-dione (PubChem CID 136912325) has the molecular formula C12H7N5O5 and a molecular weight of 301.22 g/mol. Its IUPAC name is 5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136912325 |
| Molecular Formula | C12H7N5O5 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 5-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(-c2nc(-c3ccc([N+](=O)[O-])cc3)no2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H7N5O5/c18-10-8(5-13-12(19)15-10)11-14-9(16-22-11)6-1-3-7(4-2-6)17(20)21/h1-5H,(H2,13,15,18,19) |
| InChIKey | OHKOZMFHNZHNEZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|