About 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole
3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole (PubChem CID 8895320) has the molecular formula C14H7BrN4O5
and a molecular weight of 391.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole |
| PubChem CID | 8895320 |
| Molecular Formula | C14H7BrN4O5 |
| Molecular Weight | 391.14 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccc(Br)cc3)no2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7BrN4O5/c15-9-3-1-8(2-4-9)13-16-14(24-17-13)11-6-5-10(18(20)21)7-12(11)19(22)23/h1-7H |
| InChIKey | HUTIKHPAIFUKDM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.14 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole?
The IUPAC name of 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole (CID 8895320) is 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole is O=[N+]([O-])c1ccc(-c2nc(-c3ccc(Br)cc3)no2)c([N+](=O)[O-])c1.
What is the InChIKey of 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole?
The InChIKey is HUTIKHPAIFUKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrN4O5/c15-9-3-1-8(2-4-9)13-16-14(24-17-13)11-6-5-10(18(20)21)7-12(11)19(22)23/h1-7H.
What are the key properties of 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole?
3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole has a molecular weight of 391.14 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-5-(2,4-dinitrophenyl)-1,2,4-oxadiazole is sourced from PubChem (CID 8895320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).