C12H12BrClN4O3 — CID 120864731
1-[5-(4-bromo-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride (PubChem CID 120864731) has the molecular formula C12H12BrClN4O3 and a molecular weight of 375.61 g/mol. Its IUPAC name is 1-[5-(4-bromo-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 1-[5-(4-bromo-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120864731 |
| Molecular Formula | C12H12BrClN4O3 |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 1-[5-(4-bromo-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2noc(-c3ccc(Br)cc3[N+](=O)[O-])n2)CCC1 |
| InChI | InChI=1S/C12H11BrN4O3.ClH/c13-7-2-3-8(9(6-7)17(18)19)10-15-11(16-20-10)12(14)4-1-5-12;/h2-3,6H,1,4-5,14H2;1H |
| InChIKey | NMCQGVOEBZFFSF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|