C16H21ClN4O5 — CID 120853176
1-[5-(5-ethoxy-4-methoxy-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120853176) has the molecular formula C16H21ClN4O5 and a molecular weight of 384.82 g/mol. Its IUPAC name is 1-[5-(5-ethoxy-4-methoxy-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-(5-ethoxy-4-methoxy-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120853176 |
| Molecular Formula | C16H21ClN4O5 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[5-(5-ethoxy-4-methoxy-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | CCOc1cc(-c2nc(C3(N)CCCC3)no2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C16H20N4O5.ClH/c1-3-24-13-8-10(11(20(21)22)9-12(13)23-2)14-18-15(19-25-14)16(17)6-4-5-7-16;/h8-9H,3-7,17H2,1-2H3;1H |
| InChIKey | AXBSUOOQNVBMLP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|