C12H15ClN4O3S — CID 120855214
1-[5-(5-methyl-4-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120855214) has the molecular formula C12H15ClN4O3S and a molecular weight of 330.80 g/mol. Its IUPAC name is 1-[5-(5-methyl-4-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-(5-methyl-4-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120855214 |
| Molecular Formula | C12H15ClN4O3S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-[5-(5-methyl-4-nitrothiophen-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cc1sc(-c2nc(C3(N)CCCC3)no2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H14N4O3S.ClH/c1-7-8(16(17)18)6-9(20-7)10-14-11(15-19-10)12(13)4-2-3-5-12;/h6H,2-5,13H2,1H3;1H |
| InChIKey | NVVWWUPNDNNIQC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|