C13H15ClFN5O3 — CID 120851921
2-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-fluoro-6-nitroaniline;hydrochloride (PubChem CID 120851921) has the molecular formula C13H15ClFN5O3 and a molecular weight of 343.75 g/mol. Its IUPAC name is 2-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-fluoro-6-nitroaniline;hydrochloride.
| Compound Name | 2-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-fluoro-6-nitroaniline;hydrochloride |
|---|---|
| PubChem CID | 120851921 |
| Molecular Formula | C13H15ClFN5O3 |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-fluoro-6-nitroaniline;hydrochloride |
| SMILES | Cl.Nc1c(-c2nc(C3(N)CCCC3)no2)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14FN5O3.ClH/c14-7-5-8(10(15)9(6-7)19(20)21)11-17-12(18-22-11)13(16)3-1-2-4-13;/h5-6H,1-4,15-16H2;1H |
| InChIKey | OIRVCHLPBVRKGB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|