C14H18ClN5O5S — CID 120854564
3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120854564) has the molecular formula C14H18ClN5O5S and a molecular weight of 403.85 g/mol. Its IUPAC name is 3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120854564 |
| Molecular Formula | C14H18ClN5O5S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 3-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1c(-c2nc(C3(N)CCCC3)no2)cc(S(N)(=O)=O)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H17N5O5S.ClH/c1-8-10(6-9(25(16,22)23)7-11(8)19(20)21)12-17-13(18-24-12)14(15)4-2-3-5-14;/h6-7H,2-5,15H2,1H3,(H2,16,22,23);1H |
| InChIKey | GCKQOEJLIDWKTF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 168.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|