C14H17ClN4O5S — CID 120852472
1-[5-(3-methylsulfonyl-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120852472) has the molecular formula C14H17ClN4O5S and a molecular weight of 388.83 g/mol. Its IUPAC name is 1-[5-(3-methylsulfonyl-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-(3-methylsulfonyl-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120852472 |
| Molecular Formula | C14H17ClN4O5S |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[5-(3-methylsulfonyl-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | CS(=O)(=O)c1cc(-c2nc(C3(N)CCCC3)no2)cc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H16N4O5S.ClH/c1-24(21,22)11-7-9(6-10(8-11)18(19)20)12-16-13(17-23-12)14(15)4-2-3-5-14;/h6-8H,2-5,15H2,1H3;1H |
| InChIKey | IUERSNJBJUSTDF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|