C12H13ClN4O3 — CID 120859325
1-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride (PubChem CID 120859325) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 1-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120859325 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2noc(-c3ccc([N+](=O)[O-])cc3)n2)CCC1 |
| InChI | InChI=1S/C12H12N4O3.ClH/c13-12(6-1-7-12)11-14-10(19-15-11)8-2-4-9(5-3-8)16(17)18;/h2-5H,1,6-7,13H2;1H |
| InChIKey | TWOQVNFIRCLZRV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|