C13H15ClN4O4 — CID 120861869
1-[5-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride (PubChem CID 120861869) has the molecular formula C13H15ClN4O4 and a molecular weight of 326.74 g/mol. Its IUPAC name is 1-[5-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 1-[5-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120861869 |
| Molecular Formula | C13H15ClN4O4 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-[5-[(4-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2noc(COc3ccc([N+](=O)[O-])cc3)n2)CCC1 |
| InChI | InChI=1S/C13H14N4O4.ClH/c14-13(6-1-7-13)12-15-11(21-16-12)8-20-10-4-2-9(3-5-10)17(18)19;/h2-5H,1,6-8,14H2;1H |
| InChIKey | BGIJRVGPEDCPSH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|