C14H17ClN4O4 — CID 120854893
1-[5-[(3-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120854893) has the molecular formula C14H17ClN4O4 and a molecular weight of 340.77 g/mol. Its IUPAC name is 1-[5-[(3-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-[(3-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120854893 |
| Molecular Formula | C14H17ClN4O4 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-[5-[(3-nitrophenoxy)methyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2noc(COc3cccc([N+](=O)[O-])c3)n2)CCCC1 |
| InChI | InChI=1S/C14H16N4O4.ClH/c15-14(6-1-2-7-14)13-16-12(22-17-13)9-21-11-5-3-4-10(8-11)18(19)20;/h3-5,8H,1-2,6-7,9,15H2;1H |
| InChIKey | NMSFFZRAEYQWJR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|