C17H19ClN6O3 — CID 120852480
1-[5-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120852480) has the molecular formula C17H19ClN6O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is 1-[5-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120852480 |
| Molecular Formula | C17H19ClN6O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[5-[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cl.Cn1cc(-c2nc(C3(N)CCCC3)no2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C17H18N6O3.ClH/c1-22-10-13(14(20-22)11-4-6-12(7-5-11)23(24)25)15-19-16(21-26-15)17(18)8-2-3-9-17;/h4-7,10H,2-3,8-9,18H2,1H3;1H |
| InChIKey | KKYHSWKPVJZQIP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|