C15H10N4O5 — CID 8895313
5-(2,4-dinitrophenyl)-3-(3-methylphenyl)-1,2,4-oxadiazole (PubChem CID 8895313) has the molecular formula C15H10N4O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is 5-(2,4-dinitrophenyl)-3-(3-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,4-dinitrophenyl)-3-(3-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 8895313 |
| Molecular Formula | C15H10N4O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 5-(2,4-dinitrophenyl)-3-(3-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-c2noc(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C15H10N4O5/c1-9-3-2-4-10(7-9)14-16-15(24-17-14)12-6-5-11(18(20)21)8-13(12)19(22)23/h2-8H,1H3 |
| InChIKey | AZVZFFDIXUADQJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|