C22H15N3O4 — CID 8895567
(4-methylphenyl)-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]phenyl]methanone (PubChem CID 8895567) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is (4-methylphenyl)-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]phenyl]methanone.
| Compound Name | (4-methylphenyl)-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]phenyl]methanone |
|---|---|
| PubChem CID | 8895567 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (4-methylphenyl)-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]phenyl]methanone |
| SMILES | Cc1ccc(C(=O)c2ccccc2-c2nc(-c3cccc([N+](=O)[O-])c3)no2)cc1 |
| InChI | InChI=1S/C22H15N3O4/c1-14-9-11-15(12-10-14)20(26)18-7-2-3-8-19(18)22-23-21(24-29-22)16-5-4-6-17(13-16)25(27)28/h2-13H,1H3 |
| InChIKey | BAEHMBYCUUQQJM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|