C9H8N4O3 — CID 61324782
[5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 61324782) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is [5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]methanamine.
| Compound Name | [5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]methanamine |
|---|---|
| PubChem CID | 61324782 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | [5-(2-nitrophenyl)-1,2,4-oxadiazol-3-yl]methanamine |
| SMILES | NCc1noc(-c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H8N4O3/c10-5-8-11-9(16-12-8)6-3-1-2-4-7(6)13(14)15/h1-4H,5,10H2 |
| InChIKey | CMMMAWXNTAMTBP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|