C15H12N2O4 — CID 136904028
2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol (PubChem CID 136904028) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol.
| Compound Name | 2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136904028 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol |
| SMILES | COc1cccc(-c2noc(-c3cc(O)ccc3O)n2)c1 |
| InChI | InChI=1S/C15H12N2O4/c1-20-11-4-2-3-9(7-11)14-16-15(21-17-14)12-8-10(18)5-6-13(12)19/h2-8,18-19H,1H3 |
| InChIKey | BBQHZGOLGDZEGE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|