C15H11IN2O3 — CID 136885977
4-iodo-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136885977) has the molecular formula C15H11IN2O3 and a molecular weight of 394.17 g/mol. Its IUPAC name is 4-iodo-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 4-iodo-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136885977 |
| Molecular Formula | C15H11IN2O3 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 4-iodo-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | COc1cccc(-c2noc(-c3cc(I)ccc3O)n2)c1 |
| InChI | InChI=1S/C15H11IN2O3/c1-20-11-4-2-3-9(7-11)14-17-15(21-18-14)12-8-10(16)5-6-13(12)19/h2-8,19H,1H3 |
| InChIKey | KSWJNLDFZHGLIP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|