C9H7IN2O2 — CID 136885967
4-iodo-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol (PubChem CID 136885967) has the molecular formula C9H7IN2O2 and a molecular weight of 302.07 g/mol. Its IUPAC name is 4-iodo-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol.
| Compound Name | 4-iodo-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol |
|---|---|
| PubChem CID | 136885967 |
| Molecular Formula | C9H7IN2O2 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 4-iodo-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol |
| SMILES | Cc1noc(-c2cc(I)ccc2O)n1 |
| InChI | InChI=1S/C9H7IN2O2/c1-5-11-9(14-12-5)7-4-6(10)2-3-8(7)13/h2-4,13H,1H3 |
| InChIKey | RAUHOKSDOKAFSB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|