C10H10IN3O2 — CID 136886124
2-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]-4-iodophenol (PubChem CID 136886124) has the molecular formula C10H10IN3O2 and a molecular weight of 331.11 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]-4-iodophenol.
| Compound Name | 2-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]-4-iodophenol |
|---|---|
| PubChem CID | 136886124 |
| Molecular Formula | C10H10IN3O2 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-[3-(dimethylamino)-1,2,4-oxadiazol-5-yl]-4-iodophenol |
| SMILES | CN(C)c1noc(-c2cc(I)ccc2O)n1 |
| InChI | InChI=1S/C10H10IN3O2/c1-14(2)10-12-9(16-13-10)7-5-6(11)3-4-8(7)15/h3-5,15H,1-2H3 |
| InChIKey | CNYRDODAAXROGD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|