C10H12N4O — CID 115747800
5-(2-aminophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 115747800) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-(2-aminophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-aminophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 115747800 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-(2-aminophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(-c2ccccc2N)n1 |
| InChI | InChI=1S/C10H12N4O/c1-14(2)10-12-9(15-13-10)7-5-3-4-6-8(7)11/h3-6H,11H2,1-2H3 |
| InChIKey | SBMAFLWKKCISDR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|