C10H11BrN4O — CID 116799524
5-(2-amino-5-bromophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 116799524) has the molecular formula C10H11BrN4O and a molecular weight of 283.13 g/mol. Its IUPAC name is 5-(2-amino-5-bromophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-amino-5-bromophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 116799524 |
| Molecular Formula | C10H11BrN4O |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 5-(2-amino-5-bromophenyl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(-c2cc(Br)ccc2N)n1 |
| InChI | InChI=1S/C10H11BrN4O/c1-15(2)10-13-9(16-14-10)7-5-6(11)3-4-8(7)12/h3-5H,12H2,1-2H3 |
| InChIKey | NLORXDXQDFNURQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|