C14H8Cl2N2O3 — CID 136904204
2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol (PubChem CID 136904204) has the molecular formula C14H8Cl2N2O3 and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136904204 |
| Molecular Formula | C14H8Cl2N2O3 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2nc(-c3ccc(Cl)c(Cl)c3)no2)c1 |
| InChI | InChI=1S/C14H8Cl2N2O3/c15-10-3-1-7(5-11(10)16)13-17-14(21-18-13)9-6-8(19)2-4-12(9)20/h1-6,19-20H |
| InChIKey | GKADRAKDZFWWAY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|