C14H8Cl2N2O — CID 704271
5-(3,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole (PubChem CID 704271) has the molecular formula C14H8Cl2N2O and a molecular weight of 291.14 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-(3,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 704271 |
| Molecular Formula | C14H8Cl2N2O |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)no2)cc1Cl |
| InChI | InChI=1S/C14H8Cl2N2O/c15-11-7-6-10(8-12(11)16)14-17-13(18-19-14)9-4-2-1-3-5-9/h1-8H |
| InChIKey | DLMYAGCVYXQROO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |