C14H7Cl3N2O — CID 90656750
3-phenyl-5-(2,3,4-trichlorophenyl)-1,2,4-oxadiazole (PubChem CID 90656750) has the molecular formula C14H7Cl3N2O and a molecular weight of 325.58 g/mol. Its IUPAC name is 3-phenyl-5-(2,3,4-trichlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-phenyl-5-(2,3,4-trichlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 90656750 |
| Molecular Formula | C14H7Cl3N2O |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 3-phenyl-5-(2,3,4-trichlorophenyl)-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)no2)c(Cl)c1Cl |
| InChI | InChI=1S/C14H7Cl3N2O/c15-10-7-6-9(11(16)12(10)17)14-18-13(19-20-14)8-4-2-1-3-5-8/h1-7H |
| InChIKey | LRTZVNJTJJWYOT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|