C14H10BClN2O3 — CID 75486104
[4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid (PubChem CID 75486104) has the molecular formula C14H10BClN2O3 and a molecular weight of 300.51 g/mol. Its IUPAC name is [4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid.
| Compound Name | [4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 75486104 |
| Molecular Formula | C14H10BClN2O3 |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2noc(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C14H10BClN2O3/c16-12-4-2-1-3-11(12)14-17-13(18-21-14)9-5-7-10(8-6-9)15(19)20/h1-8,19-20H |
| InChIKey | RLBBAEZQMPGLLP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|