C16H11N3O — CID 103827436
3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzonitrile (PubChem CID 103827436) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzonitrile.
| Compound Name | 3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 103827436 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)benzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C16H11N3O/c1-11-9-12(10-17)7-8-14(11)16-18-15(19-20-16)13-5-3-2-4-6-13/h2-9H,1H3 |
| InChIKey | DVRDVKVTOYDJOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |