C16H14N2O — CID 867102
5-(2-methylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 867102) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-(2-methylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-methylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 867102 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-(2-methylphenyl)-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(-c3ccccc3C)n2)cc1 |
| InChI | InChI=1S/C16H14N2O/c1-11-7-9-13(10-8-11)15-17-16(19-18-15)14-6-4-3-5-12(14)2/h3-10H,1-2H3 |
| InChIKey | GNSCVZNDOFTPRT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |