C15H11FN2O — CID 817382
3-(4-fluorophenyl)-5-(2-methylphenyl)-1,2,4-oxadiazole (PubChem CID 817382) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(2-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-fluorophenyl)-5-(2-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 817382 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(2-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccccc1-c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C15H11FN2O/c1-10-4-2-3-5-13(10)15-17-14(18-19-15)11-6-8-12(16)9-7-11/h2-9H,1H3 |
| InChIKey | NJLQXZMMAGTBPT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |