C13H9FN4O — CID 97058185
3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (PubChem CID 97058185) has the molecular formula C13H9FN4O and a molecular weight of 256.24 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 97058185 |
| Molecular Formula | C13H9FN4O |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C13H9FN4O/c14-9-5-3-8(4-6-9)12-17-13(19-18-12)10-2-1-7-16-11(10)15/h1-7H,(H2,15,16) |
| InChIKey | BQSFZJBKEZAHMD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |