C17H9FN2O4 — CID 20904234
3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-8-hydroxychromen-2-one (PubChem CID 20904234) has the molecular formula C17H9FN2O4 and a molecular weight of 324.27 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-8-hydroxychromen-2-one.
| Compound Name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-8-hydroxychromen-2-one |
|---|---|
| PubChem CID | 20904234 |
| Molecular Formula | C17H9FN2O4 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-8-hydroxychromen-2-one |
| SMILES | O=c1oc2c(O)cccc2cc1-c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H9FN2O4/c18-11-6-4-9(5-7-11)15-19-16(24-20-15)12-8-10-2-1-3-13(21)14(10)23-17(12)22/h1-8,21H |
| InChIKey | QRTMCYZZXUTIOV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|