C25H18N2O4 — CID 22424784
3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-8-phenylmethoxychromen-2-one (PubChem CID 22424784) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-8-phenylmethoxychromen-2-one.
| Compound Name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-8-phenylmethoxychromen-2-one |
|---|---|
| PubChem CID | 22424784 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-8-phenylmethoxychromen-2-one |
| SMILES | Cc1ccc(-c2noc(-c3cc4cccc(OCc5ccccc5)c4oc3=O)n2)cc1 |
| InChI | InChI=1S/C25H18N2O4/c1-16-10-12-18(13-11-16)23-26-24(31-27-23)20-14-19-8-5-9-21(22(19)30-25(20)28)29-15-17-6-3-2-4-7-17/h2-14H,15H2,1H3 |
| InChIKey | BQQAGRDXLDFUSW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|