C15H12N2O2 — CID 63851081
2-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)phenol (PubChem CID 63851081) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)phenol.
| Compound Name | 2-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)phenol |
|---|---|
| PubChem CID | 63851081 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)phenol |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)no2)cc1O |
| InChI | InChI=1S/C15H12N2O2/c1-10-7-8-12(9-13(10)18)15-16-14(17-19-15)11-5-3-2-4-6-11/h2-9,18H,1H3 |
| InChIKey | ANIBDOKGCPCIAV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |