C15H10Cl2N2O2 — CID 107918283
5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol (PubChem CID 107918283) has the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol.
| Compound Name | 5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
|---|---|
| PubChem CID | 107918283 |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 5-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
| SMILES | Cc1ccc(-c2nc(-c3cc(Cl)cc(Cl)c3)no2)cc1O |
| InChI | InChI=1S/C15H10Cl2N2O2/c1-8-2-3-9(6-13(8)20)15-18-14(19-21-15)10-4-11(16)7-12(17)5-10/h2-7,20H,1H3 |
| InChIKey | LVCNAPOPXUWTPM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |