C15H11FN2O3 — CID 123369622
[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanediol (PubChem CID 123369622) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is [3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanediol.
| Compound Name | [3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanediol |
|---|---|
| PubChem CID | 123369622 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]methanediol |
| SMILES | OC(O)c1cccc(-c2noc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C15H11FN2O3/c16-12-7-2-1-6-11(12)14-17-13(18-21-14)9-4-3-5-10(8-9)15(19)20/h1-8,15,19-20H |
| InChIKey | GQLBSAPFQDIJIX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|