C27H35FN2O9 — CID 143556785
2-[2-[2-[2-[2-[2-[[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-hydroxymethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 143556785) has the molecular formula C27H35FN2O9 and a molecular weight of 550.58 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-hydroxymethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-[[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-hydroxymethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 143556785 |
| Molecular Formula | C27H35FN2O9 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-hydroxymethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCOCCOCCOC(O)c1cccc(-c2noc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C27H35FN2O9/c28-24-7-2-1-6-23(24)26-29-25(30-39-26)21-4-3-5-22(20-21)27(32)38-19-18-37-17-16-36-15-14-35-13-12-34-11-10-33-9-8-31/h1-7,20,27,31-32H,8-19H2 |
| InChIKey | WILQGYSZRCVHTH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|