C23H25FN2O6 — CID 142953500
2-[2-(3-methoxypropoxy)ethoxy]ethyl 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 142953500) has the molecular formula C23H25FN2O6 and a molecular weight of 444.46 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethoxy]ethyl 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | 2-[2-(3-methoxypropoxy)ethoxy]ethyl 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 142953500 |
| Molecular Formula | C23H25FN2O6 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethoxy]ethyl 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COCCCOCCOCCOC(=O)c1cccc(-c2noc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C23H25FN2O6/c1-28-10-5-11-29-12-13-30-14-15-31-23(27)18-7-4-6-17(16-18)21-25-22(32-26-21)19-8-2-3-9-20(19)24/h2-4,6-9,16H,5,10-15H2,1H3 |
| InChIKey | YYTWZCGHUIVBNF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|