C16H11F3N2O4 — CID 167105376
[3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanediol (PubChem CID 167105376) has the molecular formula C16H11F3N2O4 and a molecular weight of 352.27 g/mol. Its IUPAC name is [3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanediol.
| Compound Name | [3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanediol |
|---|---|
| PubChem CID | 167105376 |
| Molecular Formula | C16H11F3N2O4 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [3-[5-[3-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methanediol |
| SMILES | OC(O)c1cccc(-c2noc(-c3cccc(OC(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C16H11F3N2O4/c17-16(18,19)24-12-6-2-4-10(8-12)14-20-13(21-25-14)9-3-1-5-11(7-9)15(22)23/h1-8,15,22-23H |
| InChIKey | FHNQHSGYZZNFCJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|