C13H13ClF2N2O2 — CID 175189888
5-[chloro(difluoro)methyl]-3-[3-[(2-methylpropan-2-yl)oxy]phenyl]-1,2,4-oxadiazole (PubChem CID 175189888) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-3-[3-[(2-methylpropan-2-yl)oxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[chloro(difluoro)methyl]-3-[3-[(2-methylpropan-2-yl)oxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 175189888 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-3-[3-[(2-methylpropan-2-yl)oxy]phenyl]-1,2,4-oxadiazole |
| SMILES | CC(C)(C)Oc1cccc(-c2noc(C(F)(F)Cl)n2)c1 |
| InChI | InChI=1S/C13H13ClF2N2O2/c1-12(2,3)19-9-6-4-5-8(7-9)10-17-11(20-18-10)13(14,15)16/h4-7H,1-3H3 |
| InChIKey | PPKDKCSGNNSALC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|