C16H8Cl2F5N3O — CID 175179342
2-chloro-N-[3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4-(trifluoromethyl)aniline (PubChem CID 175179342) has the molecular formula C16H8Cl2F5N3O and a molecular weight of 424.16 g/mol. Its IUPAC name is 2-chloro-N-[3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 175179342 |
| Molecular Formula | C16H8Cl2F5N3O |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 2-chloro-N-[3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(Nc2cccc(-c3noc(C(F)(F)Cl)n3)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl2F5N3O/c17-11-7-9(16(21,22)23)4-5-12(11)24-10-3-1-2-8(6-10)13-25-14(27-26-13)15(18,19)20/h1-7,24H |
| InChIKey | HQZIYLHDHCVQSF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|