C16H12ClF3N3O2P — CID 162734185
N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]-methylphosphoryl]aniline (PubChem CID 162734185) has the molecular formula C16H12ClF3N3O2P and a molecular weight of 401.71 g/mol. Its IUPAC name is N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]-methylphosphoryl]aniline.
| Compound Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]-methylphosphoryl]aniline |
|---|---|
| PubChem CID | 162734185 |
| Molecular Formula | C16H12ClF3N3O2P |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]-methylphosphoryl]aniline |
| SMILES | CP(=O)(Nc1ccccc1)c1ccc(-c2noc(C(F)(F)Cl)n2)cc1F |
| InChI | InChI=1S/C16H12ClF3N3O2P/c1-26(24,23-11-5-3-2-4-6-11)13-8-7-10(9-12(13)18)14-21-15(25-22-14)16(17,19)20/h2-9H,1H3,(H,23,24) |
| InChIKey | FIUJZIARGNXUCE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|