C16H12Cl3F2N4O2P — CID 162734168
2,4-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]aniline (PubChem CID 162734168) has the molecular formula C16H12Cl3F2N4O2P and a molecular weight of 467.63 g/mol. Its IUPAC name is 2,4-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]aniline.
| Compound Name | 2,4-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]aniline |
|---|---|
| PubChem CID | 162734168 |
| Molecular Formula | C16H12Cl3F2N4O2P |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2,4-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]aniline |
| SMILES | CP(=O)(Cc1ccc(-c2noc(C(F)(F)Cl)n2)cn1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3F2N4O2P/c1-28(26,25-13-5-3-10(17)6-12(13)18)8-11-4-2-9(7-22-11)14-23-15(27-24-14)16(19,20)21/h2-7H,8H2,1H3,(H,25,26) |
| InChIKey | IAMCRYCMVPYBHF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|