C17H14ClF4N4O3P — CID 162734336
N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]-2,4-difluoroaniline (PubChem CID 162734336) has the molecular formula C17H14ClF4N4O3P and a molecular weight of 464.74 g/mol. Its IUPAC name is N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]-2,4-difluoroaniline.
| Compound Name | N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 162734336 |
| Molecular Formula | C17H14ClF4N4O3P |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]-2,4-difluoroaniline |
| SMILES | CCOP(=O)(Cc1ccc(-c2noc(C(F)(F)Cl)n2)cn1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H14ClF4N4O3P/c1-2-28-30(27,26-14-6-4-11(19)7-13(14)20)9-12-5-3-10(8-23-12)15-24-16(29-25-15)17(18,21)22/h3-8H,2,9H2,1H3,(H,26,27) |
| InChIKey | OEWJSPJJMBAAOV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|