C17H14Cl3F2N4O3P — CID 162734297
2,6-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]aniline (PubChem CID 162734297) has the molecular formula C17H14Cl3F2N4O3P and a molecular weight of 497.65 g/mol. Its IUPAC name is 2,6-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]aniline.
| Compound Name | 2,6-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]aniline |
|---|---|
| PubChem CID | 162734297 |
| Molecular Formula | C17H14Cl3F2N4O3P |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | 2,6-dichloro-N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-ethoxyphosphoryl]aniline |
| SMILES | CCOP(=O)(Cc1ccc(-c2noc(C(F)(F)Cl)n2)cn1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl3F2N4O3P/c1-2-28-30(27,26-14-12(18)4-3-5-13(14)19)9-11-7-6-10(8-23-11)15-24-16(29-25-15)17(20,21)22/h3-8H,2,9H2,1H3,(H,26,27) |
| InChIKey | NECTXONYOCOSPJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|